AB44201
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $17.00 | $12.00 | - + | |
250mg | 98% | in stock | $23.00 | $16.00 | - + | |
1g | 98% | in stock | $38.00 | $27.00 | - + | |
5g | 98% | in stock | $110.00 | $77.00 | - + | |
25g | 98% | in stock | $303.00 | $212.00 | - + | |
100g | 98% | in stock | $860.00 | $602.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB44201 |
Chemical Name: | 2'-O-Methyladenosine |
CAS Number: | 2140-79-6 |
Molecular Formula: | C11H15N5O4 |
Molecular Weight: | 281.2679 |
MDL Number: | MFCD00056002 |
SMILES: | CO[C@@H]1[C@H](O)[C@H](O[C@H]1n1cnc2c1ncnc2N)CO |
Complexity: | 349 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 3 |
XLogP3: | -0.5 |
2'-O-Methyladenosine is a pivotal compound in chemical synthesis, commonly employed in the modification of RNA molecules. This modification serves to enhance the stability and efficiency of RNA, making it a valuable tool in molecular biology research and therapeutic applications. By incorporating 2'-O-Methyladenosine into RNA sequences, researchers can manipulate the structure and function of RNA, allowing for targeted studies of gene expression and interactions within cellular processes. Furthermore, the unique properties of 2'-O-Methyladenosine make it highly suitable for studying RNA-protein interactions and RNA folding dynamics, providing valuable insights into the mechanisms underlying biological functions. Overall, the strategic use of 2'-O-Methyladenosine in chemical synthesis offers a versatile approach to RNA modification, showcasing its potential for advancing diverse fields of scientific inquiry.
PLoS pathogens 20120401
Journal of nucleic acids 20120101
BMC plant biology 20100101
Journal of immunology (Baltimore, Md. : 1950) 20080301
Electrophoresis 20071101
Bioorganic & medicinal chemistry 20070815
Journal of medicinal chemistry 20070809
Virology journal 20050101
Journal of the American Chemical Society 20041117
Journal of medicinal chemistry 20040422
RNA (New York, N.Y.) 20030801
Journal of molecular biology 20021122
Biochemical pharmacology 19770415