AB60399
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $9.00 | $7.00 | - + | |
25g | 98% | in stock | $26.00 | $18.00 | - + | |
500g | 98% | in stock | $463.00 | $324.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB60399 |
Chemical Name: | 2,5-Dichloro-3-nitropyridine |
CAS Number: | 21427-62-3 |
Molecular Formula: | C5H2Cl2N2O2 |
Molecular Weight: | 192.9876 |
MDL Number: | MFCD06658963 |
SMILES: | Clc1cnc(c(c1)[N+](=O)[O-])Cl |
Complexity: | 161 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 3 |
XLogP3: | 2.3 |
2,5-Dichloro-3-nitropyridine is a valuable compound utilized in various chemical synthesis processes. Its unique chemical properties make it a versatile building block in the creation of pharmaceuticals, agrochemicals, and advanced materials. This compound serves as a key intermediate in the synthesis of biologically active compounds, making it a crucial component in drug discovery and development. Additionally, its presence in the production of specialty chemicals highlights its significance in the manufacturing industry. Overall, 2,5-Dichloro-3-nitropyridine plays a critical role in catalyzing complex chemical reactions and unlocking new possibilities in the realm of organic synthesis.