AB54600
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $40.00 | $28.00 | - + | |
5g | 97% | in stock | $114.00 | $80.00 | - + | |
10g | 97% | in stock | $179.00 | $125.00 | - + | |
25g | 97% | in stock | $364.00 | $255.00 | - + | |
100g | 97% | in stock | $1,094.00 | $766.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB54600 |
Chemical Name: | (1R,2R)-(-)-2-Benzyloxycyclohexylamine |
CAS Number: | 216394-06-8 |
Molecular Formula: | C13H19NO |
Molecular Weight: | 205.2960600000001 |
MDL Number: | MFCD01075752 |
SMILES: | N[C@@H]1CCCC[C@H]1OCc1ccccc1 |
Complexity: | 177 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 2 |
Cyclohexanamine, 2-(phenylmethoxy)-, (1R,2R)- is a versatile compound widely utilized in chemical synthesis processes. Its chirality, represented by the (1R,2R) configuration, makes it particularly valuable for the development of enantioselective reactions.In organic chemistry, Cyclohexanamine, 2-(phenylmethoxy)-, (1R,2R)- serves as a chiral building block in the synthesis of various pharmaceuticals, agrochemicals, and fine chemicals. Its unique structure and reactivity enable the creation of complex molecular structures with high levels of stereochemical control. This compound is frequently employed in asymmetric transformations, including catalytic hydrogenation, metal-catalyzed reactions, and organocatalysis.Furthermore, Cyclohexanamine, 2-(phenylmethoxy)-, (1R,2R)- can act as a versatile intermediate in the preparation of chiral ligands, ligand precursors, and other valuable compounds used in advanced chemical transformations. Its role in facilitating the creation of enantiopure molecules highlights its significance in modern synthetic organic chemistry.