AY15797
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $16.00 | $11.00 | - + | |
1g | 97% | in stock | $42.00 | $29.00 | - + | |
5g | 97% | in stock | $146.00 | $102.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AY15797 |
Chemical Name: | 6-Aminopyrimidine-4-carboxylic acid compound with sulfuric acid (2:1) |
CAS Number: | 2173116-22-6 |
Molecular Formula: | C10H12N6O8S |
Molecular Weight: | 376.3027 |
MDL Number: | MFCD31619106 |
SMILES: | OS(=O)(=O)O.Nc1cc(ncn1)C(=O)O.Nc1cc(ncn1)C(=O)O |