218290-24-5 | N,N'-(trans-Cyclohexane-1,2-diyl)dipicolinamide

Packsize	Purity	Availability	Price	Discounted Price
250mg	98%	in stock	$25.00	$17.00
1g	98%	in stock	$42.00	$30.00

Description

• Catalog Number: AB55769
• Chemical Name: N,N'-(trans-Cyclohexane-1,2-diyl)dipicolinamide
• CAS Number: 218290-24-5
• Molecular Formula: C18H20N4O2
• Molecular Weight: 324.377
• MDL Number: MFCD02684543
• SMILES: O=C(c1ccccn1)NC1CCCCC1NC(=O)c1ccccn1

Upstream Synthesis Route

N,N'-(trans-Cyclohexane-1,2-diyl)dipicolinamide is a versatile compound widely employed in chemical synthesis as a complexing agent and ligand in coordination chemistry. Due to its unique structure and chelating properties, this compound plays a crucial role in the formation of coordination complexes with various metal ions. In chemical synthesis, it serves as a key building block for the creation of diverse coordination polymers and supramolecular assemblies, offering a platform for the design and construction of novel materials with tailored properties. Its ability to coordinate with metal ions enables precise control over the structure and properties of the resulting materials, making it a valuable tool for the development of advanced functional materials and catalysts. Additionally, N,N'-(trans-Cyclohexane-1,2-diyl)dipicolinamide's utility in chemical synthesis extends to the fields of medicinal chemistry and materials science, where its unique coordination chemistry is leveraged for the synthesis of biologically active compounds and innovative materials with potential applications in various technological fields.