AF43186
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $36.00 | $26.00 | - + | |
250mg | 97% | in stock | $77.00 | $54.00 | - + | |
1g | 97% | in stock | $276.00 | $193.00 | - + | |
5g | 97% | in stock | $1,050.00 | $735.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF43186 |
Chemical Name: | (1R,2S,5S)-3-(tert-Butoxycarbonyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid |
CAS Number: | 219754-02-6 |
Molecular Formula: | C13H21NO4 |
Molecular Weight: | 255.31013999999996 |
MDL Number: | MFCD15147269 |
SMILES: | OC(=O)[C@H]1N(C[C@H]2[C@@H]1C2(C)C)C(=O)OC(C)(C)C |
Complexity: | 396 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 3 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 2 |
The (1R,2S,5S)-3-(tert-Butoxycarbonyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid serves as a versatile building block in chemical synthesis due to its unique structure and functional groups. Its configuration and substituents make it an important intermediate in the synthesis of various pharmaceuticals, particularly those targeting neurological disorders and infectious diseases. In synthetic organic chemistry, this compound can be utilized as a key precursor for the preparation of complex molecules through strategic bond formations and functional group manipulations. Its presence in the synthesis pathway enables the introduction of chirality and specific functionalities that are crucial for the desired bioactivity of the final compounds. The use of (1R,2S,5S)-3-(tert-Butoxycarbonyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid exemplifies its significance in designing and constructing molecules with tailored properties and applications.