AB73941
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $25.00 | $18.00 | - + | |
1g | 98% | in stock | $31.00 | $22.00 | - + | |
5g | 98% | in stock | $96.00 | $67.00 | - + | |
25g | 98% | in stock | $317.00 | $222.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB73941 |
Chemical Name: | Ethyl 6-bromocoumarin-3-carboxylate |
CAS Number: | 2199-90-8 |
Molecular Formula: | C12H9BrO4 |
Molecular Weight: | 297.1015 |
MDL Number: | MFCD00124584 |
SMILES: | CCOC(=O)c1cc2cc(Br)ccc2oc1=O |
Complexity: | 364 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 3 |
XLogP3: | 3 |
Journal of medicinal chemistry 20110113
Acta crystallographica. Section C, Crystal structure communications 20070401