BN91149
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | 1 week | $129.00 | $91.00 | - + | |
5mg | 95% | 1 week | $307.00 | $215.00 | - + | |
10mg | 95% | 1 week | $448.00 | $314.00 | - + | |
25mg | 95% | 1 week | $707.00 | $495.00 | - + | |
50mg | 95% | 1 week | $944.00 | $661.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | BN91149 |
Chemical Name: | cpd.5 of 2234271-86-2 |
CAS Number: | 2234284-82-1 |
Molecular Formula: | C12H2NO3 |
Molecular Weight: | 208.1492 |
SMILES: | [CH2]OC1=C2[N][C]=C(C2=[C][C]=[C]1)/[C]=[C]/C(=O)[O] |