AI45347
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10g | 98% | in stock | $9.00 | $6.00 | - + | |
25g | 98% | in stock | $18.00 | $13.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI45347 |
Chemical Name: | 2,2'-Anhydro-5-methyluridine |
CAS Number: | 22423-26-3 |
Molecular Formula: | C10H12N2O5 |
Molecular Weight: | 240.2127 |
MDL Number: | MFCD00233555 |
SMILES: | OC[C@H]1O[C@@H]2[C@H]([C@@H]1O)Oc1n2cc(C)c(=O)n1 |
Complexity: | 432 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | -2.1 |
Bioorganic & medicinal chemistry 20050301
Journal of medicinal chemistry 19791001