BA07923
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $81.00 | $57.00 | - + | |
250mg | 95% | in stock | $135.00 | $95.00 | - + | |
1g | 95% | in stock | $354.00 | $248.00 | - + | |
5g | 95% | in stock | $1,232.00 | $862.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | BA07923 |
Chemical Name: | Potassium ((1-[(tert-butoxy)carbonyl]azetidin-3-yl)methyl)trifluoroboranuide |
CAS Number: | 2254447-10-2 |
Molecular Formula: | C9H16BF3KNO2 |
Molecular Weight: | 277.1333 |
MDL Number: | MFCD18712403 |
SMILES: | F[B-](CC1CN(C1)C(=O)OC(C)(C)C)(F)F.[K+] |
The upstream synthesis route of Potassium ((1-[(tert-butoxy)carbonyl]azetidin-3-yl)methyl)trifluoroboranuide is as follows: 1. Synthesis of 3-Azetidinemethanol: Start with the preparation of 3-azetidinemethanol from β-lactams by nucleophilic ring opening, typically using reagents such as methylamine under pressure or benzylamine, followed by reduction if necessary. 2. Boc Protection: Subject 3-azetidinemethanol to tert-butoxycarbonyl (Boc) protection using di-tert-butyl dicarbonate (Boc2O) in the presence of a suitable base like pyridine or triethylamine, to yield 1-[(tert-butoxy)carbonyl]azetidin-3-yl)methanol. 3. Introduction of Trifluoroborane: React the protected 3-azetidinemethanol with a trifluoroborating agent, usually in the form of an alkali metal (such as potassium) salt like potassium trifluoro(borate) under anhydrous conditions to obtain the final product, Potassium ((1-[(tert-butoxy)carbonyl]azetidin-3-yl)methyl)trifluoroboranuide. It is crucial to maintain anhydrous conditions to prevent hydrolysis of trifluoroborane and to use a non-coordinating solvent such as tetrahydrofuran (THF) in the final step. Purification can be performed via recrystallization or column chromatography depending on the specific impurities present.