AD56994
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 96% | in stock | $10.00 | $7.00 | - + | |
1g | 96% | in stock | $17.00 | $12.00 | - + | |
5g | ≥97% | in stock | $23.00 | $16.00 | - + | |
10g | 95% | in stock | $28.00 | $20.00 | - + | |
25g | 95% | in stock | $65.00 | $46.00 | - + | |
100g | 96% | in stock | $249.00 | $174.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD56994 |
Chemical Name: | (S)-1-Boc-2-cyanopyrrolidine |
CAS Number: | 228244-04-0 |
Molecular Formula: | C10H16N2O2 |
Molecular Weight: | 196.2462 |
MDL Number: | MFCD01861224 |
SMILES: | N#C[C@@H]1CCCN1C(=O)OC(C)(C)C |
Complexity: | 272 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 2 |
XLogP3: | 1.4 |
Journal of medicinal chemistry 20091112