AB21284
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
500mg | 98% | in stock | $5.00 | $3.00 | - + | |
1g | 97% | in stock | $8.00 | $6.00 | - + | |
5g | 95% | in stock | $19.00 | $14.00 | - + | |
10g | 95% | in stock | $37.00 | $26.00 | - + | |
25g | 95% | in stock | $74.00 | $52.00 | - + | |
100g | 95% | in stock | $238.00 | $167.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB21284 |
Chemical Name: | (1S,4R)-1-Methyl-4-(prop-1-en-2-yl)cyclohex-2-enol |
CAS Number: | 22972-51-6 |
Molecular Formula: | C10H16O |
Molecular Weight: | 152.2334 |
MDL Number: | MFCD08460036 |
SMILES: | CC(=C)[C@@H]1CC[C@](C=C1)(C)O |
Complexity: | 193 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.4 |
Phytomedicine : international journal of phytotherapy and phytopharmacology 20110915
Journal of agricultural and food chemistry 20020911