AB21592
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 97% | in stock | $6.00 | $4.00 | - + | |
10g | 97% | in stock | $7.00 | $5.00 | - + | |
25g | 97% | in stock | $15.00 | $11.00 | - + | |
100g | 97% | in stock | $58.00 | $41.00 | - + | |
500g | 97% | in stock | $134.00 | $94.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB21592 |
Chemical Name: | Z-Asn-OH |
CAS Number: | 2304-96-3 |
Molecular Formula: | C12H14N2O5 |
Molecular Weight: | 266.2500 |
MDL Number: | MFCD00008035 |
SMILES: | O=C(N[C@H](C(=O)O)CC(=O)N)OCc1ccccc1 |
Complexity: | 339 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 7 |
XLogP3: | -0.1 |
Applied biochemistry and biotechnology 20100201
American journal of respiratory cell and molecular biology 20060301
Biochemical pharmacology 19991015