AB21645
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $19.00 | $13.00 | - + | |
1g | 95% | in stock | $26.00 | $18.00 | - + | |
5g | 95% | in stock | $79.00 | $55.00 | - + | |
10g | 95% | in stock | $79.00 | $56.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB21645 |
Chemical Name: | Cis-1,3-cyclohexanedicarboxylic acid |
CAS Number: | 2305-31-9 |
Molecular Formula: | C8H12O4 |
Molecular Weight: | 172.1785 |
MDL Number: | MFCD01311240 |
SMILES: | OC(=O)[C@@H]1CCC[C@@H](C1)C(=O)O |
Complexity: | 179 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 0.7 |
The Journal of organic chemistry 20080704