AB21849
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $8.00 | $6.00 | - + | |
5g | 98% | in stock | $11.00 | $8.00 | - + | |
10g | 98% | in stock | $18.00 | $13.00 | - + | |
25g | 98% | in stock | $36.00 | $25.00 | - + | |
100g | 98% | in stock | $126.00 | $88.00 | - + | |
500g | 98% | in stock | $573.00 | $402.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB21849 |
Chemical Name: | Methyl 3-(4-hydroxy-3-methoxyphenyl)acrylate |
CAS Number: | 2309-07-1 |
Molecular Formula: | C11H12O4 |
Molecular Weight: | 208.2106 |
MDL Number: | MFCD00017208 |
SMILES: | COC(=O)C=Cc1ccc(c(c1)OC)O |
NSC Number: | 74548 |
Complexity: | 237 |
Covalently-Bonded Unit Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 1.8 |
Bioorganic & medicinal chemistry letters 20121001
Archives of pharmacal research 20080501
Bioorganic & medicinal chemistry letters 20070515