AB22917
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $15.00 | $10.00 | - + | |
5g | 98% | in stock | $26.00 | $18.00 | - + | |
25g | 98% | in stock | $45.00 | $32.00 | - + | |
100g | 98% | in stock | $140.00 | $98.00 | - + | |
500g | 98% | in stock | $643.00 | $450.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB22917 |
Chemical Name: | (1S,2R)-(+)-2-Amino-1,2-diphenylethanol |
CAS Number: | 23364-44-5 |
Molecular Formula: | C14H15NO |
Molecular Weight: | 213.2750 |
MDL Number: | MFCD00074959 |
SMILES: | N[C@@H]([C@H](c1ccccc1)O)c1ccccc1 |
Complexity: | 195 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | 1.3 |
Chirality 20100101
Bioorganic & medicinal chemistry 20090501
Chirality 20090401
The Journal of organic chemistry 20011130
Chemistry (Weinheim an der Bergstrasse, Germany) 20010316