AB63563
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $18.00 | $13.00 | - + | |
5g | 97% | in stock | $50.00 | $35.00 | - + | |
10g | 97% | in stock | $66.00 | $47.00 | - + | |
25g | 97% | in stock | $148.00 | $103.00 | - + | |
100g | 97% | in stock | $444.00 | $311.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB63563 |
Chemical Name: | 3,3'-Dihydroxybenzidine |
CAS Number: | 2373-98-0 |
Molecular Formula: | C12H12N2O2 |
Molecular Weight: | 216.23587999999998 |
MDL Number: | MFCD00039149 |
SMILES: | Nc1ccc(cc1O)c1ccc(c(c1)O)N |
4,4'-Diamino-3,3'-dihydroxybiphenyl, also known as DADHB, is a versatile compound widely used in chemical synthesis as a key building block for various processes. Its unique structure and properties make it an essential component in the production of dyes, pigments, and pharmaceutical compounds.In chemical synthesis, 4,4'-Diamino-3,3'-dihydroxybiphenyl plays a crucial role as a starting material in the development of organic molecules. Its ability to undergo various reactions, such as coupling, substitution, and condensation reactions, makes it a valuable tool for creating complex structures with specific functionalities.Due to its dual amino and hydroxyl groups, DADHB can participate in both nucleophilic and electrophilic reactions, allowing for a wide range of functionalization possibilities. This versatility makes it a preferred choice for researchers and chemists working on the synthesis of novel compounds with tailored properties.In summary, 4,4'-Diamino-3,3'-dihydroxybiphenyl is an indispensable component in chemical synthesis, offering a multitude of opportunities for designing and constructing intricate molecular frameworks with diverse applications in various industries.