logo
Home  > Chemistry  > Organic Building Blocks  > Anhydrides  > 5,6-Dibromohexahydro-2-benzofuran-1,3-dione

AD56056

23893-84-7 | 5,6-Dibromohexahydro-2-benzofuran-1,3-dione

Packsize Purity Availability Price Discounted Price    Quantity
100mg 97% in stock $113.00 $79.00 -   +
250mg 97% in stock $218.00 $152.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AD56056
Chemical Name: 5,6-Dibromohexahydro-2-benzofuran-1,3-dione
CAS Number: 23893-84-7
Molecular Formula: C8H8Br2O3
Molecular Weight: 311.9553
MDL Number: MFCD08445355
SMILES: BrC1CC2C(=O)OC(=O)C2CC1Br

 

Computed Properties
Complexity: 240  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 13  
Hydrogen Bond Acceptor Count: 3  
Undefined Atom Stereocenter Count: 4  
XLogP3: 1.7  

 

 

Upstream Synthesis Route
  • 5,6-Dibromohexahydroisobenzofuran-1,3-dione is a versatile chemical compound widely used in chemical synthesis. This compound is essential in the development of various pharmaceuticals, agrochemicals, and materials due to its unique molecular structure and reactivity. In chemical synthesis, 5,6-Dibromohexahydroisobenzofuran-1,3-dione serves as a key building block for the construction of complex organic molecules. Its bromine substituents provide opportunities for selective functionalization reactions, making it a valuable intermediate in the synthesis of intricate chemical structures. By leveraging the specific properties of 5,6-Dibromohexahydroisobenzofuran-1,3-dione, chemists can efficiently access a diverse range of compounds with tailored properties and functionalities. This compound plays a crucial role in the advancement of synthetic chemistry, enabling the creation of novel molecules with potential applications across various industries.
FEATURED PRODUCTS