AB46346
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $12.00 | $8.00 | - + | |
250mg | 98% | in stock | $28.00 | $19.00 | - + | |
1g | 98% | in stock | $50.00 | $35.00 | - + | |
5g | 98% | in stock | $235.00 | $164.00 | - + | |
10g | 98% | in stock | $426.00 | $298.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB46346 |
Chemical Name: | 4,7,13,16,21,24-Hexaoxa-1,10-diazabicyclo[8.8.8]hexacosane |
CAS Number: | 23978-09-8 |
Molecular Formula: | C18H36N2O6 |
Molecular Weight: | 376.4882 |
MDL Number: | MFCD00005111 |
SMILES: | C1COCCN2CCOCCOCCN(CCO1)CCOCCOCC2 |
NSC Number: | 264495 |
Complexity: | 247 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 26 |
Hydrogen Bond Acceptor Count: | 8 |
XLogP3: | -1 |
4,7,13,16,21,24-Hexaoxa-1,10-diazabicyclo[8.8.8]hexacosane, commonly known as $name$, is a versatile compound used extensively in chemical synthesis. Its unique molecular structure makes it an essential component in organic chemistry processes, particularly in the formation of complex molecules and polymers. In chemical synthesis, $name$ serves as a highly efficient catalyst for various reactions due to its rigid and well-defined framework. Its ability to facilitate transformations such as ring-closing reactions, oxidation processes, and polymerization makes it a valuable tool for chemists working in diverse fields. Additionally, $name$ can act as a chelating agent, coordinating with metal ions to enhance catalytic activity in certain reactions.Furthermore, $name$ plays a crucial role in the development of novel materials and pharmaceuticals. Its controlled reactivity and selectivity enable chemists to design and construct specific molecular architectures with high precision. Whether used in the synthesis of biologically active compounds or advanced materials, $name$ offers a reliable and efficient solution for chemical researchers seeking to expand the frontiers of molecular science.
Nature protocols 20121101
Journal of chromatography. A 20121019
Chemistry (Weinheim an der Bergstrasse, Germany) 20120917
Dalton transactions (Cambridge, England : 2003) 20120514
Nuclear medicine communications 20120501
Chemical communications (Cambridge, England) 20110321
Angewandte Chemie (International ed. in English) 20100308
Chemistry (Weinheim an der Bergstrasse, Germany) 20100208
Acta crystallographica. Section E, Structure reports online 20091101
Applied radiation and isotopes : including data, instrumentation and methods for use in agriculture, industry and medicine 20090901
Chemphyschem : a European journal of chemical physics and physical chemistry 20081006
Nuclear medicine and biology 20080201
Nuclear medicine and biology 20080201
Acta crystallographica. Section B, Structural science 20070201
Journal of the American Chemical Society 20031119
Journal of chromatography. A 20030516
Journal of the American Chemical Society 20020918
Nuclear medicine and biology 20020101