BG38115
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | 1 week | $154.00 | $108.00 | - + | |
2mg | 95% | 1 week | $207.00 | $145.00 | - + | |
5mg | 95% | 1 week | $315.00 | $221.00 | - + | |
10mg | >99% pure by Achiral and Chiral HPLCs | 1 week | $425.00 | $298.00 | - + | |
25mg | 95% | 1 week | $761.00 | $533.00 | - + | |
50mg | 95% | 1 week | $1,063.00 | $744.00 | - + | |
100mg | 95% | 1 week | $1,422.00 | $995.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | BG38115 |
Chemical Name: | KB-0742 2HCl |
CAS Number: | 2416874-75-2 |
Molecular Formula: | C16H27Cl2N5 |
Molecular Weight: | 360.3251 |
SMILES: | CCC(c1cc(N[C@H]2CC[C@@H](C2)N)n2c(n1)ccn2)CC.Cl.Cl |