AB25140
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $23.00 | $16.00 | - + | |
5g | 95% | in stock | $52.00 | $37.00 | - + | |
10g | 95% | in stock | $100.00 | $70.00 | - + | |
25g | 95% | in stock | $243.00 | $171.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB25140 |
Chemical Name: | 2-Hydroxy-4-nitrobenzaldehyde |
CAS Number: | 2460-58-4 |
Molecular Formula: | C7H5NO4 |
Molecular Weight: | 167.1189 |
MDL Number: | MFCD00049373 |
SMILES: | O=Cc1ccc(cc1O)[N+](=O)[O-] |
NSC Number: | 82622 |
Complexity: | 188 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 2 |
Journal of molecular modeling 20120101
Chemical communications (Cambridge, England) 20090121