AB43164
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 97% | in stock | $7.00 | $5.00 | - + | |
25g | 97% | in stock | $15.00 | $11.00 | - + | |
100g | 97% | in stock | $53.00 | $37.00 | - + | |
500g | 96% | in stock | $251.00 | $176.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB43164 |
Chemical Name: | 1,4-Bis(methylamino)anthraquinone |
CAS Number: | 2475-44-7 |
Molecular Formula: | C16H14N2O2 |
Molecular Weight: | 266.2946 |
MDL Number: | MFCD00001198 |
SMILES: | CNc1ccc(c2c1C(=O)c1ccccc1C2=O)NC |
NSC Number: | 86161 |
Complexity: | 371 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 3.9 |
Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy 20070701
Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy 20021101