AB27083
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 97% | in stock | $13.00 | $9.00 | - + | |
10g | 97% | in stock | $20.00 | $14.00 | - + | |
100g | 97% | in stock | $185.00 | $129.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB27083 |
Chemical Name: | 1,3-Bis(2,6-diisopropylphenyl)imidazolium chloride |
CAS Number: | 250285-32-6 |
Molecular Formula: | C27H39ClN2 |
Molecular Weight: | 427.065 |
MDL Number: | MFCD02684545 |
SMILES: | CC(c1cccc(c1N1C=C[NH+](C1)c1c(cccc1C(C)C)C(C)C)C(C)C)C.[Cl-] |
Complexity: | 421 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 30 |
Hydrogen Bond Acceptor Count: | 1 |
Rotatable Bond Count: | 6 |
1,3-Bis(2,6-diisopropylphenyl)imidazolium chloride is a versatile compound widely used in chemical synthesis for its unique properties. This compound serves as an efficient and selective organocatalyst in various reactions, including asymmetric transformations and cross-coupling reactions. Its sterically bulky 2,6-diisopropylphenyl groups impart substantial steric hindrance, leading to enhanced regioselectivity and improved catalytic activity. Additionally, the imidazolium core provides stability and facilitates the formation of active intermediates crucial for catalysis. In summary, 1,3-Bis(2,6-diisopropylphenyl)imidazolium chloride plays a crucial role in promoting diverse chemical transformations with high efficiency and selectivity.