AB27549
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 96% | in stock | $32.00 | $22.00 | - + | |
1g | 96% | in stock | $116.00 | $82.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB27549 |
Chemical Name: | 2,3-Dioxoindoline-5-carboxylic acid |
CAS Number: | 25128-32-9 |
Molecular Formula: | C9H5NO4 |
Molecular Weight: | 191.1403 |
MDL Number: | MFCD00967204 |
SMILES: | O=C1Nc2c(C1=O)cc(cc2)C(=O)O |
Complexity: | 312 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 0.2 |
Journal of medicinal chemistry 20060615