AF28072
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $41.00 | $29.00 | - + | |
250mg | 95% | in stock | $56.00 | $40.00 | - + | |
1g | 95% | in stock | $70.00 | $49.00 | - + | |
10g | 95% | in stock | $665.00 | $466.00 | - + | |
25g | 95% | in stock | $1,317.00 | $922.00 | - + | |
100g | 95% | in stock | $3,929.00 | $2,750.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF28072 |
Chemical Name: | 8-Bromo-5-nitroisoquinoline |
CAS Number: | 252861-41-9 |
Molecular Formula: | C9H5BrN2O2 |
Molecular Weight: | 253.0522 |
MDL Number: | MFCD08282783 |
SMILES: | [O-][N+](=O)c1ccc(c2c1ccnc2)Br |
Complexity: | 231 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
XLogP3: | 2.6 |
8-Bromo-5-nitroisoquinoline is a versatile compound widely utilized in chemical synthesis for its unique properties and reactivity. This compound serves as a valuable building block in organic chemistry, particularly in the development of pharmaceuticals, agrochemicals, and materials science. Due to its electron-withdrawing nitro and bromo substituents, 8-bromo-5-nitroisoquinoline exhibits a high degree of electrophilicity, making it a valuable intermediate in various synthetic pathways. In chemical synthesis, 8-Bromo-5-nitroisoquinoline is commonly employed as a key starting material for the construction of complex molecules through functional group manipulations, such as nucleophilic substitutions, cross-coupling reactions, and cyclization processes. Its versatile nature allows for the introduction of diverse functional groups, enabling the facile modification of molecular structures to tailor properties for specific applications.Moreover, the presence of the bromine and nitro groups in 8-Bromo-5-nitroisoquinoline imparts unique reactivity profiles that enable selective transformations and regioselective reactions. This compound has found utility in the synthesis of biologically active compounds, fluorescent dyes, and advanced materials due to its ability to facilitate diverse chemical reactions with high efficiency and control.Overall, 8-Bromo-5-nitroisoquinoline plays a crucial role in advancing the field of synthetic chemistry by enabling the efficient construction of complex molecules with tailored functionalities for various applications in pharmaceuticals, materials science, and beyond.