AF31328
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $106.00 | $75.00 | - + | |
1g | 95% | in stock | $227.00 | $159.00 | - + | |
5g | 95% | in stock | $643.00 | $450.00 | - + | |
10g | 95% | in stock | $1,063.00 | $744.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF31328 |
Chemical Name: | Butyl-a-d-glucopyranoside |
CAS Number: | 25320-93-8 |
Molecular Formula: | C10H20O6 |
Molecular Weight: | 236.2622 |
MDL Number: | MFCD08704048 |
SMILES: | CCCCO[C@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
Complexity: | 200 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 5 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 5 |
XLogP3: | -0.9 |
Zhongguo Zhong yao za zhi = Zhongguo zhongyao zazhi = China journal of Chinese materia medica 20120501
Biotechnology letters 20090901
Carbohydrate research 20030422