BL40098
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 95% | 1 week | $753.00 | $527.00 | - + | |
100mg | 95% | 1 week | $1,086.00 | $761.00 | - + | |
250mg | 95% | 1 week | $1,516.00 | $1,062.00 | - + | |
500mg | 95% | 1 week | $2,343.00 | $1,640.00 | - + | |
1g | 95% | 1 week | $2,981.00 | $2,087.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | BL40098 |
Chemical Name: | 6-(trifluoromethyl)-5H,6H,7H,8H-imidazo[1,2-a]pyridine-8-carboxylic acid hydrochloride, Mixture of diastereomers |
CAS Number: | 2551116-79-9 |
Molecular Formula: | C9H10ClF3N2O2 |
Molecular Weight: | 270.6361 |
MDL Number: | MFCD32874461 |
SMILES: | OC(=O)C1CC(Cn2c1ncc2)C(F)(F)F.Cl |