AI45962
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $9.00 | $6.00 | - + | |
5g | 95% | in stock | $14.00 | $10.00 | - + | |
10g | 95% | in stock | $15.00 | $10.00 | - + | |
25g | 95% | in stock | $20.00 | $14.00 | - + | |
100g | 95% | in stock | $58.00 | $41.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI45962 |
Chemical Name: | Cbz-Gly-Gly-OH |
CAS Number: | 2566-19-0 |
Molecular Formula: | C12H14N2O5 |
Molecular Weight: | 266.25 |
MDL Number: | MFCD00037783 |
SMILES: | O=C(OCc1ccccc1)NCC(=O)NCC(=O)O |
NSC Number: | 29727 |
Complexity: | 326 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 7 |
XLogP3: | 0.4 |
Journal of medicinal chemistry 20160428