AB43922
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $42.00 | $30.00 | - + | |
5g | 98% | in stock | $119.00 | $83.00 | - + | |
25g | 98% | in stock | $419.00 | $293.00 | - + | |
100g | 98% | in stock | $1,540.00 | $1,078.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB43922 |
Chemical Name: | 2-Chloro-3,5-dinitropyridine |
CAS Number: | 2578-45-2 |
Molecular Formula: | C5H2ClN3O4 |
Molecular Weight: | 203.5401 |
MDL Number: | MFCD00006233 |
SMILES: | [O-][N+](=O)c1cnc(c(c1)[N+](=O)[O-])Cl |
Complexity: | 225 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 5 |
XLogP3: | 1.5 |
Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy 20060901