AB57240
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $10.00 | $7.00 | - + | |
1g | 98% | in stock | $12.00 | $9.00 | - + | |
5g | 98% | in stock | $15.00 | $11.00 | - + | |
10g | 98% | in stock | $29.00 | $21.00 | - + | |
25g | 98% | in stock | $67.00 | $47.00 | - + | |
100g | 98% | in stock | $206.00 | $144.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB57240 |
Chemical Name: | 1,3-bis(2,6-diisopropylphenyl)-4,5-dihydro-1H-imidazol-3-ium chloride |
CAS Number: | 258278-25-0 |
Molecular Formula: | C27H39ClN2 |
Molecular Weight: | 427.065 |
MDL Number: | MFCD07369796 |
SMILES: | CC(c1cccc(c1N1CC[N+](=C1)c1c(cccc1C(C)C)C(C)C)C(C)C)C.[Cl-] |
Complexity: | 467 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 30 |
Hydrogen Bond Acceptor Count: | 1 |
Rotatable Bond Count: | 6 |
1H-Imidazolium, 1,3-bis[2,6-bis(1-methylethyl)phenyl]-4,5-dihydro-, chloride (1:1) is a versatile compound utilized in the field of chemical synthesis. This particular compound plays a crucial role as a catalyst in various organic transformations, particularly in the realm of asymmetric reactions. Its unique structure confers it with the ability to facilitate a wide range of reactions with high efficiency and selectivity.In the realm of chemical synthesis, 1H-Imidazolium, 1,3-bis[2,6-bis(1-methylethyl)phenyl]-4,5-dihydro-, chloride (1:1) is frequently employed in the formation of carbon-carbon bonds through cross-coupling reactions. It serves as an effective catalyst for Suzuki, Heck, and Sonogashira reactions, enabling the synthesis of a diverse array of complex organic molecules. Additionally, this compound has shown promise in promoting cycloaddition reactions, offering a streamlined route to constructing cyclic structures with high stereochemical control.Furthermore, 1H-Imidazolium, 1,3-bis[2,6-bis(1-methylethyl)phenyl]-4,5-dihydro-, chloride (1:1) is a valuable tool in the synthesis of pharmaceutical intermediates and fine chemicals. Its ability to drive challenging transformations with remarkable efficiency makes it a sought-after reagent in the development of novel synthetic methodologies. Researchers and chemists rely on this compound to expedite the synthesis of complex molecules with precision and reliability, pushing the boundaries of chemical synthesis towards innovative and sustainable practices.