AB28329
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $13.00 | $9.00 | - + | |
5g | 97% | in stock | $15.00 | $10.00 | - + | |
10g | 97% | in stock | $25.00 | $18.00 | - + | |
25g | 97% | in stock | $45.00 | $31.00 | - + | |
100g | 97% | in stock | $98.00 | $69.00 | - + | |
500g | 97% | in stock | $449.00 | $314.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB28329 |
Chemical Name: | 1,2:5,6-Di-O-isopropylidene-alpha-D-allofuranose |
CAS Number: | 2595-05-3 |
Molecular Formula: | C12H20O6 |
Molecular Weight: | 260.2836 |
MDL Number: | MFCD00135634 |
SMILES: | O[C@@H]1[C@H](O[C@H]2[C@@H]1OC(O2)(C)C)[C@H]1COC(O1)(C)C |
Complexity: | 342 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 5 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
European journal of medicinal chemistry 20101201
Organic letters 20060330
Archives of pharmacal research 20050201
Chemical communications (Cambridge, England) 20011207