AB28498
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25mg | 98% | in stock | $98.00 | $68.00 | - + | |
50mg | 98% | in stock | $186.00 | $130.00 | - + | |
100mg | 98% | in stock | $245.00 | $171.00 | - + | |
250mg | 98% | in stock | $366.00 | $256.00 | - + | |
1g | 98% | in stock | $913.00 | $639.00 | - + | |
5g | 98% | in stock | $3,835.00 | $2,684.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB28498 |
Chemical Name: | 2,18:3,17-Dimethano-2,3,4a,5a,6a,7a,8a,9a,10a,11a,12a,13a,14a,15a,17,18,19a,20a,21a,22a,23a,24a,25a,26a,27a,28a,29a,30a-octacosaazabispentaleno[1''''',6''''':5'''',6'''',7'''']cycloocta[1'''',2'''',3'''':3''',4''']pentaleno[1''',6''':5'',6'',7'']cycloocta[1'',2'',3'':3',4']pentaleno[1',6':5,6,7]cycloocta[1,2,3-cd:1',2',3'-gh]pentalene-1,4,6,8,10,12,14,16,19,21,23,25,27,29-tetradecone, tetradecahydro-, stereoisomer |
CAS Number: | 259886-50-5 |
Molecular Formula: | C42H42N28O14 |
Molecular Weight: | 1162.9621 |
MDL Number: | MFCD31720083 |
SMILES: | O=C1N2CN3C(=O)N4C5C3N3CN6C2C2N1CN1C(=O)N7C8C1N(CN2C6=O)C(=O)N8CN1C2N(C7)C(=O)N6C2N(C1=O)CN1C2N(C6)C(=O)N6C2N(C1=O)CN1C2C7N(CN8C(=O)N(C4)C4N(CN5C3=O)C(=O)N(C84)CN7C1=O)C(=O)N2C6 |
Cucurbit[7]uril is a unique macrocyclic molecule that has found extensive applications in chemical synthesis due to its ability to encapsulate guest molecules within its cavity. This unique property of Cucurbit[7]uril allows it to act as a molecular container, facilitating various chemical reactions and processes.In chemical synthesis, Cucurbit[7]uril is often used as a supramolecular host for guest molecules, enabling the formation of inclusion complexes. These inclusion complexes can serve as reaction vessels, protecting the guest molecules from external factors and promoting specific interactions between the encapsulated molecules. This controlled environment offered by Cucurbit[7]uril can lead to enhanced selectivity, efficiency, and yield in various chemical reactions.Moreover, the host-guest interactions facilitated by Cucurbit[7]uril can also be utilized in the purification and separation of molecules. Cucurbit[7]uril's ability to selectively encapsulate specific guest molecules allows for the isolation of target compounds from complex mixtures, aiding in the purification process.Overall, the versatile applications of Cucurbit[7]uril in chemical synthesis make it a valuable tool for chemists in designing and conducting a wide range of reactions with improved control and efficiency.