BL37716
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 95% | 1 week | $634.00 | $444.00 | - + | |
100mg | 95% | 1 week | $907.00 | $635.00 | - + | |
250mg | 95% | 1 week | $1,258.00 | $881.00 | - + | |
500mg | 95% | 1 week | $1,937.00 | $1,356.00 | - + | |
1g | 95% | 1 week | $2,464.00 | $1,725.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | BL37716 |
Chemical Name: | 6-(bromomethyl)-8,8-difluorodispiro[2.0.3^{4}.1^{3}]octane, Mixture of diastereomers |
CAS Number: | 2624140-23-2 |
Molecular Formula: | C9H11BrF2 |
Molecular Weight: | 237.0844 |
MDL Number: | MFCD33550344 |
SMILES: | BrCC1CC2(C1)C1(C2(F)F)CC1 |