logo
Home  > Dicyclohexylamine 2-cyanoacrylate

AB30598

263703-32-8 | Dicyclohexylamine 2-cyanoacrylate

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $47.00 $33.00 -   +
250mg 95% in stock $66.00 $47.00 -   +
1g 95% in stock $148.00 $104.00 -   +
5g 95% in stock $712.00 $498.00 -   +
10g 95% in stock $1,178.00 $824.00 -   +
25g 95% in stock $2,344.00 $1,641.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AB30598
Chemical Name: Dicyclohexylamine 2-cyanoacrylate
CAS Number: 263703-32-8
Molecular Formula: C16H26N2O2
Molecular Weight: 278.3898
MDL Number: MFCD27920710
SMILES: C1CCC(CC1)NC1CCCCC1.OC(=O)C(=C)C#N

 

Upstream Synthesis Route 
  • N-Cyclohexylcyclohexanaminium 2-cyanoacrylate is a versatile compound that finds application in chemical synthesis as a valuable catalyst. Its unique properties allow for the efficient and selective formation of carbon-carbon bonds in various organic reactions. By facilitating the activation of cyanoacrylate monomers, this compound serves as a catalyst in polymerization processes, enabling the production of high-quality adhesives and coatings. Additionally, N-Cyclohexylcyclohexanaminium 2-cyanoacrylate has been utilized in the synthesis of complex molecules and pharmaceutical intermediates, demonstrating its importance in the field of organic chemistry. Its ability to promote specific reactions and control reaction pathways makes it a crucial tool for chemists seeking to design novel compounds and optimize synthetic routes.
FEATURED PRODUCTS