AB31345
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $15.00 | $10.00 | - + | |
5g | 98%(HPLC) | in stock | $24.00 | $17.00 | - + | |
25g | 98%(HPLC) | in stock | $33.00 | $23.00 | - + | |
100g | 97% | in stock | $74.00 | $52.00 | - + | |
500g | 97% | in stock | $251.00 | $176.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB31345 |
Chemical Name: | Z-Gln-OH |
CAS Number: | 2650-64-8 |
Molecular Formula: | C13H16N2O5 |
Molecular Weight: | 280.2765 |
MDL Number: | MFCD00008043 |
SMILES: | O=C(N[C@H](C(=O)O)CCC(=O)N)OCc1ccccc1 |
Complexity: | 353 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 8 |
XLogP3: | 0.3 |
Beilstein journal of organic chemistry 20110101