AB31820
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $7.00 | $5.00 | - + | |
10g | 98% | in stock | $9.00 | $6.00 | - + | |
25g | ≥98% | in stock | $15.00 | $10.00 | - + | |
500g | 98% | in stock | $177.00 | $124.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB31820 |
Chemical Name: | Z-D-Ala-OH |
CAS Number: | 26607-51-2 |
Molecular Formula: | C11H13NO4 |
Molecular Weight: | 223.2252 |
MDL Number: | MFCD00063126 |
SMILES: | C[C@H](C(=O)O)NC(=O)OCc1ccccc1 |
Complexity: | 248 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 5 |
XLogP3: | 1.4 |
Bioorganic & medicinal chemistry 20081201
The Journal of organic chemistry 20030502