BL33814
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 95% | 1 week | $634.00 | $444.00 | - + | |
100mg | 95% | 1 week | $907.00 | $635.00 | - + | |
250mg | 95% | 1 week | $1,258.00 | $881.00 | - + | |
500mg | 95% | 1 week | $1,937.00 | $1,356.00 | - + | |
1g | 95% | 1 week | $2,464.00 | $1,725.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | BL33814 |
Chemical Name: | 6-bromo-2-ethyl-2,3-dihydro-1-benzofuran-3-amine hydrochloride, Mixture of diastereomers |
CAS Number: | 2680537-29-3 |
Molecular Formula: | C10H13BrClNO |
Molecular Weight: | 278.5733 |
MDL Number: | MFCD34186587 |
SMILES: | CCC1Oc2c(C1N)ccc(c2)Br.Cl |