AB43013
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 96% | in stock | $15.00 | $10.00 | - + | |
5g | 96% | in stock | $16.00 | $11.00 | - + | |
10g | 96% | in stock | $23.00 | $16.00 | - + | |
25g | 96% | in stock | $38.00 | $26.00 | - + | |
100g | 96% | in stock | $99.00 | $69.00 | - + | |
500g | 96% | in stock | $413.00 | $289.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB43013 |
Chemical Name: | [Hydroxy(tosyloxy)iodo]benzene |
CAS Number: | 27126-76-7 |
Molecular Formula: | C13H13IO4S |
Molecular Weight: | 392.2094 |
MDL Number: | MFCD00011547 |
SMILES: | Cc1ccc(cc1)S(=O)(=O)O[I](c1ccccc1)O |
NSC Number: | 294176 |
Complexity: | 365 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 3.7 |
The Journal of organic chemistry 20110121
Molecules (Basel, Switzerland) 20050131