AI46280
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $6.00 | $4.00 | - + | |
5g | 98% | in stock | $7.00 | $5.00 | - + | |
10g | 98% | in stock | $9.00 | $6.00 | - + | |
25g | 98% | in stock | $20.00 | $14.00 | - + | |
100g | 98% | in stock | $79.00 | $55.00 | - + | |
500g | 98% | in stock | $273.00 | $191.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI46280 |
Chemical Name: | S-Trityl-3-mercaptopropionic acid |
CAS Number: | 27144-18-9 |
Molecular Formula: | C22H20O2S |
Molecular Weight: | 348.4580 |
MDL Number: | MFCD00237291 |
SMILES: | OC(=O)CCSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
NSC Number: | 96707 |
Complexity: | 359 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 25 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 7 |
XLogP3: | 5 |
Journal of medicinal chemistry 20080313