AB47585
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $8.00 | $5.00 | - + | |
1g | 95% | in stock | $20.00 | $14.00 | - + | |
5g | 95% | in stock | $72.00 | $50.00 | - + | |
10g | 95% | in stock | $129.00 | $90.00 | - + | |
25g | 95% | in stock | $268.00 | $187.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB47585 |
Chemical Name: | (+/-)-(1R,5S,6S)-tert-Butyl 6-amino-3-azabicyclo[3.1.0]hexane-3-carboxylate |
CAS Number: | 273206-92-1 |
Molecular Formula: | C10H18N2O2 |
Molecular Weight: | 198.2621 |
MDL Number: | MFCD09832898 |
SMILES: | N[C@@H]1[C@@H]2[C@H]1CN(C2)C(=O)OC(C)(C)C |
Complexity: | 247 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 0.3 |
The tert-Butyl rel-(1R,5S,6S)-6-amino-3-azabicyclo[3.1.0]hexane-3-carboxylate holds significant importance in chemical synthesis, particularly in the realm of drug design and development. This compound serves as a versatile building block in the formation of complex organic molecules, acting as a key intermediate in the synthesis of pharmaceutical compounds. By incorporating this compound into chemical reactions, chemists can efficiently access structurally diverse derivatives that exhibit potential therapeutic properties. Its unique structure and reactivity make it a valuable tool for constructing novel molecular architectures with specific biological activities.