AD53212
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $235.00 | $165.00 | - + | |
1g | 95% | in stock | $449.00 | $315.00 | - + | |
5g | 95% | in stock | $1,070.00 | $749.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD53212 |
Chemical Name: | Acetamide,2,2-dichloro-N-[3-(trifluoromethyl)phenyl]- |
CAS Number: | 2837-61-8 |
Molecular Formula: | C9H6Cl2F3NO |
Molecular Weight: | 272.0512 |
MDL Number: | MFCD00095746 |
SMILES: | O=C(C(Cl)Cl)Nc1cccc(c1)C(F)(F)F |
NSC Number: | 136281 |
Complexity: | 258 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 3.9 |
European journal of medicinal chemistry 20100901