AB34334
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $6.00 | $4.00 | - + | |
5mg | 98% | in stock | $14.00 | $10.00 | - + | |
10mg | 98% | in stock | $20.00 | $14.00 | - + | |
50mg | 98% | in stock | $56.00 | $39.00 | - + | |
250mg | 95% | in stock | $270.00 | $189.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB34334 |
Chemical Name: | Ccg-1423 |
CAS Number: | 285986-88-1 |
Molecular Formula: | C18H13ClF6N2O3 |
Molecular Weight: | 454.7508 |
MDL Number: | MFCD01566719 |
SMILES: | O=C(C(ONC(=O)c1cc(cc(c1)C(F)(F)F)C(F)(F)F)C)Nc1ccc(cc1)Cl |
NSC Number: | 742825 |
Complexity: | 586 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 30 |
Hydrogen Bond Acceptor Count: | 9 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 5 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 4.9 |
The Journal of pharmacology and experimental therapeutics 20140601
Cell 20140130
Bioorganic & medicinal chemistry letters 20130701
The Journal of clinical investigation 20110301
Biochemical and biophysical research communications 20100319
Bioorganic & medicinal chemistry letters 20100115
Current medicinal chemistry 20090101
Molecular cancer therapeutics 20070801