AB42872
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $16.00 | $11.00 | - + | |
5g | 95% | in stock | $19.00 | $13.00 | - + | |
10g | 95% | in stock | $25.00 | $17.00 | - + | |
25g | 95% | in stock | $30.00 | $21.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB42872 |
Chemical Name: | (2R)-1-[(tert-butoxy)carbonyl]piperidine-2-carboxylic acid |
CAS Number: | 28697-17-8 |
Molecular Formula: | C11H19NO4 |
Molecular Weight: | 229.2729 |
MDL Number: | MFCD00237380 |
SMILES: | OC(=O)[C@H]1CCCCN1C(=O)OC(C)(C)C |
Complexity: | 282 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 1.8 |
Bioorganic & medicinal chemistry letters 20101101
Journal of the American Chemical Society 20100908