BN54459
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | BN54459 |
Chemical Name: | N-(Carboxymethyl)-2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-N,N-dimethylethanaminium hydrochloride |
CAS Number: | 2892648-32-5 |
Molecular Formula: | C21H26ClN2O4 |
Molecular Weight: | 405.8951 |
SMILES: | OC(=O)C[N+](CCNC(=O)OCC1c2ccccc2-c2c1cccc2)(C)C.Cl |
The compound N-(Carboxymethyl)-2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-N,N-dimethylethanaminium hydrochloride serves as a versatile reagent in chemical synthesis, particularly in the field of organic chemistry. Its unique structure allows for precise manipulation of molecular structures and enables the synthesis of complex organic compounds.This compound is commonly employed as a protecting group for amines in organic synthesis. By selectively masking the amino group with the N-(Carboxymethyl) moiety, unwanted reactions with other functional groups can be avoided, thus facilitating the synthesis of intricate molecules. Additionally, the presence of the fluorenylmethoxycarbonyl (Fmoc) moiety provides an additional layer of protection for the amino group, ensuring controlled and efficient synthesis processes.Furthermore, the N-(Carboxymethyl)-2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-N,N-dimethylethanaminium hydrochloride can also serve as a crucial intermediate in the preparation of peptide compounds. Its ability to selectively protect and activate specific functional groups makes it an invaluable tool for the assembly of peptide chains in a controlled and sequential manner.Overall, the application of this compound in chemical synthesis showcases its significance in enabling precise and controlled manipulation of molecular structures, thereby advancing research and innovation in the field of organic chemistry.