AB37093
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $22.00 | $15.00 | - + | |
250mg | 97% | in stock | $26.00 | $18.00 | - + | |
1g | 97% | in stock | $43.00 | $30.00 | - + | |
5g | 97% | in stock | $123.00 | $86.00 | - + | |
25g | 97% | in stock | $435.00 | $304.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB37093 |
Chemical Name: | Ethyl 7-oxo-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxylate |
CAS Number: | 29274-18-8 |
Molecular Formula: | C9H9N3O3 |
Molecular Weight: | 207.1861 |
MDL Number: | MFCD00104600 |
SMILES: | CCOC(=O)c1c[nH]c2n(c1=O)ncc2 |
Complexity: | 409 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 0.1 |
Journal of medicinal chemistry 20060420