AB37610
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $7.00 | $5.00 | - + | |
5g | 98% | in stock | $10.00 | $7.00 | - + | |
10g | 95% | in stock | $11.00 | $8.00 | - + | |
25g | 95% | in stock | $23.00 | $17.00 | - + | |
100g | 95% | in stock | $91.00 | $64.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB37610 |
Chemical Name: | 6-Nitrobenzothiazole |
CAS Number: | 2942-06-5 |
Molecular Formula: | C7H4N2O2S |
Molecular Weight: | 180.1839 |
MDL Number: | MFCD00014569 |
SMILES: | [O-][N+](=O)c1ccc2c(c1)scn2 |
NSC Number: | 170646 |
Complexity: | 194 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
XLogP3: | 1.8 |
European journal of medicinal chemistry 20040801