AB38580
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 99% | in stock | $15.00 | $10.00 | - + | |
1g | 99% | in stock | $22.00 | $15.00 | - + | |
5g | 98% | in stock | $33.00 | $23.00 | - + | |
25g | 98% | in stock | $98.00 | $69.00 | - + | |
100g | 98% | in stock | $286.00 | $200.00 | - + | |
500g | 98% | in stock | $747.00 | $523.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB38580 |
Chemical Name: | (R)-2-Hydroxy-4-phenylbutyric acid |
CAS Number: | 29678-81-7 |
Molecular Formula: | C10H12O3 |
Molecular Weight: | 180.2005 |
MDL Number: | MFCD00192219 |
SMILES: | O[C@@H](C(=O)O)CCc1ccccc1 |
Complexity: | 162 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 4 |
XLogP3: | 1.3 |
Chemical communications (Cambridge, England) 20100428
Biotechnology progress 20070101
Biotechnology and bioengineering 20051020
Biotechnology and bioengineering 20030420