AX66747
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $46.00 | $32.00 | - + | |
5mg | 98% | in stock | $52.00 | $36.00 | - + | |
10mg | 98% | in stock | $93.00 | $65.00 | - + | |
25mg | 98% | in stock | $179.00 | $126.00 | - + | |
50mg | 98% | in stock | $249.00 | $174.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX66747 |
Chemical Name: | 5-bromo-5'-phenyl-spiro[3H-indole-3,2'(3'H)-[1,3,4]thiadiazol]-2(1H)-one |
CAS Number: | 297180-15-5 |
Molecular Formula: | C15H10BrN3OS |
Molecular Weight: | 360.2284 |
MDL Number: | MFCD00770315 |
SMILES: | Brc1ccc2c(c1)C1(NN=C(S1)c1ccccc1)C(=O)N2 |
With its unique structural moiety, 5-Bromo-5'-phenyl-3'H-spiro[indoline-3,2'-[1,3,4]thiadiazol]-2-one serves as a versatile building block in chemical synthesis. This compound showcases exceptional reactivity in various transformations, making it an essential component in the development of novel organic compounds. Its spirocyclic motif offers a diverse range of synthetic pathways, enabling the construction of complex molecular architectures. In the realm of chemical synthesis, 5-Bromo-5'-phenyl-3'H-spiro[indoline-3,2'-[1,3,4]thiadiazol]-2-one plays a crucial role as a key intermediate for the creation of pharmacologically active compounds, materials with optoelectronic properties, and other valuable products. Its strategic incorporation in synthetic routes facilitates the rapid assembly of molecular structures with desired functionalities, making it a valuable tool for chemists and researchers in the field.