AB79655
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
200mg | 97% | in stock | $23.00 | $16.00 | - + | |
1g | 97% | in stock | $25.00 | $17.00 | - + | |
5g | 97% | in stock | $60.00 | $42.00 | - + | |
25g | 97% | in stock | $201.00 | $141.00 | - + | |
100g | 97% | in stock | $603.00 | $422.00 | - + | |
500g | 97% | in stock | $2,375.00 | $1,662.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB79655 |
Chemical Name: | Mtt |
CAS Number: | 298-93-1 |
Molecular Formula: | C18H16BrN5S |
Molecular Weight: | 414.3221 |
MDL Number: | MFCD00011964 |
SMILES: | Cc1sc(nc1C)n1nc(n[n+]1c1ccccc1)c1ccccc1.[Br-] |
The compound 3-(4,5-Dimethylthiazolyl)-2,5-diphenyl-2H-tetrazolium bromide, commonly referred to as MTT, is widely used in chemical synthesis as a colorimetric assay reagent. Its application in chemical synthesis primarily lies in its role as a indicator for cell viability and proliferation in various biological assays. In the context of chemical synthesis, MTT is often employed to assess the cytotoxicity of newly synthesized compounds or evaluate the effectiveness of drug delivery systems. By measuring the reduction of MTT to formazan by cellular enzymes, researchers can quantitatively determine the viability and metabolic activity of cells treated with different chemical entities, providing valuable insights into their potential applications in pharmacology and toxicology studies.