AB42781
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $5.00 | $4.00 | - + | |
5g | 98% | in stock | $15.00 | $11.00 | - + | |
10g | 95% | in stock | $24.00 | $17.00 | - + | |
25g | 95% | in stock | $49.00 | $35.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB42781 |
Chemical Name: | (1S,2S)-(-)-1,2-Diphenylethylenediamine |
CAS Number: | 29841-69-8 |
Molecular Formula: | C14H16N2 |
Molecular Weight: | 212.2902 |
MDL Number: | MFCD00082751 |
SMILES: | N[C@H]([C@H](c1ccccc1)N)c1ccccc1 |
Complexity: | 171 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | 1.4 |
Organic & biomolecular chemistry 20120807
The Journal of organic chemistry 20120120
Carbohydrate research 20110906
Chemical communications (Cambridge, England) 20110407
Analytical and bioanalytical chemistry 20110301
Inorganic chemistry 20101101
Dalton transactions (Cambridge, England : 2003) 20100614
Molecules (Basel, Switzerland) 20091026
Journal of medicinal chemistry 20090910
Bioorganic & medicinal chemistry 20090501
Inorganic chemistry 20090420
Environmental health : a global access science source 20090101
Journal of the American Chemical Society 20080910
Organic letters 20080904
Bioorganic & medicinal chemistry 20080215
Chemical communications (Cambridge, England) 20050714
Inorganic chemistry 20050627